C26H26BBrF3N3O3 — CID 159348060
5-bromo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-one;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (PubChem CID 159348060) has the molecular formula C26H26BBrF3N3O3 and a molecular weight of 576.22 g/mol. Its IUPAC name is 5-bromo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-one;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole.
| Compound Name | 5-bromo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-one;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
|---|---|
| PubChem CID | 159348060 |
| Molecular Formula | C26H26BBrF3N3O3 |
| Molecular Weight | 576.22 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | 5-bromo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridin-2-one;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| SMILES | CC1(C)OB(c2ccc3cn[nH]c3c2)OC1(C)C.O=c1ccc(Br)cn1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17BN2O2.C13H9BrF3NO/c1-12(2)13(3,4)18-14(17-12)10-6-5-9-8-15-16-11(9)7-10;14-11-5-6-12(19)18(8-11)7-9-1-3-10(4-2-9)13(15,16)17/h5-8H,1-4H3,(H,15,16);1-6,8H,7H2 |
| InChIKey | LGYZVMQWCOAXIK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.22 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|