C20H34O6Si — CID 15934809
ethyl (E)-3-[(2R,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-oxoethylidene)oxan-2-yl]prop-2-enoate (PubChem CID 15934809) has the molecular formula C20H34O6Si and a molecular weight of 398.57 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-oxoethylidene)oxan-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-oxoethylidene)oxan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 15934809 |
| Molecular Formula | C20H34O6Si |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | ethyl (E)-3-[(2R,3S,4E)-3-[tert-butyl(dimethyl)silyl]oxy-4-(2-ethoxy-2-oxoethylidene)oxan-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1OCC/C(=C\C(=O)OCC)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O6Si/c1-8-23-17(21)11-10-16-19(26-27(6,7)20(3,4)5)15(12-13-25-16)14-18(22)24-9-2/h10-11,14,16,19H,8-9,12-13H2,1-7H3/b11-10+,15-14+/t16-,19+/m1/s1 |
| InChIKey | KMIDZCCXFVBCOX-JRXXWWDQSA-N |
| XLogP | 3.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|