C23H42O6 — CID 15934934
(3R,5R)-7-[(1R,2S,3R)-2-(2,2-dimethylbutanoyloxymethyl)-3-propylcyclohexyl]-3,5-dihydroxyheptanoic acid (PubChem CID 15934934) has the molecular formula C23H42O6 and a molecular weight of 414.58 g/mol. Its IUPAC name is (3R,5R)-7-[(1R,2S,3R)-2-(2,2-dimethylbutanoyloxymethyl)-3-propylcyclohexyl]-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[(1R,2S,3R)-2-(2,2-dimethylbutanoyloxymethyl)-3-propylcyclohexyl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 15934934 |
| Molecular Formula | C23H42O6 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (3R,5R)-7-[(1R,2S,3R)-2-(2,2-dimethylbutanoyloxymethyl)-3-propylcyclohexyl]-3,5-dihydroxyheptanoic acid |
| SMILES | CCC[C@@H]1CCC[C@H](CC[C@@H](O)C[C@@H](O)CC(=O)O)[C@H]1COC(=O)C(C)(C)CC |
| InChI | InChI=1S/C23H42O6/c1-5-8-16-9-7-10-17(11-12-18(24)13-19(25)14-21(26)27)20(16)15-29-22(28)23(3,4)6-2/h16-20,24-25H,5-15H2,1-4H3,(H,26,27)/t16-,17-,18-,19-,20+/m1/s1 |
| InChIKey | NEKAZEXAFPCIDR-WAPOTWQKSA-N |
| XLogP | 4.17 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |