About 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene
1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene (PubChem CID 159349569) has the molecular formula C16H29NO
and a molecular weight of 251.41 g/mol. Its IUPAC name is 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene.
Molecular Properties
| Compound Name | 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene |
| PubChem CID | 159349569 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene |
| SMILES | C.C.CC1CCN(C)C1=O.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C6H11NO.2CH4/c1-7-3-5-8(2)6-4-7;1-5-3-4-7(2)6(5)8;;/h3-6H,1-2H3;5H,3-4H2,1-2H3;2*1H4 |
| InChIKey | LHDSLHDEGWQEJC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene?
The IUPAC name of 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene (CID 159349569) is 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene.
What is the SMILES notation for 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene?
The canonical SMILES for 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene is C.C.CC1CCN(C)C1=O.Cc1ccc(C)cc1.
What is the InChIKey of 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene?
The InChIKey is LHDSLHDEGWQEJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C6H11NO.2CH4/c1-7-3-5-8(2)6-4-7;1-5-3-4-7(2)6(5)8;;/h3-6H,1-2H3;5H,3-4H2,1-2H3;2*1H4.
What are the key properties of 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene?
1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene has a molecular weight of 251.41 g/mol, XLogP of 4.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrrolidin-2-one;methane;1,4-xylene is sourced from PubChem (CID 159349569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).