C27H30O3 — CID 15934996
(1R,2S,3S)-3-(4-hydroxy-3-methoxyphenyl)-2,4,6-trimethyl-1-(2-phenylethyl)-2,3-dihydro-1H-inden-5-ol (PubChem CID 15934996) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is (1R,2S,3S)-3-(4-hydroxy-3-methoxyphenyl)-2,4,6-trimethyl-1-(2-phenylethyl)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | (1R,2S,3S)-3-(4-hydroxy-3-methoxyphenyl)-2,4,6-trimethyl-1-(2-phenylethyl)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 15934996 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (1R,2S,3S)-3-(4-hydroxy-3-methoxyphenyl)-2,4,6-trimethyl-1-(2-phenylethyl)-2,3-dihydro-1H-inden-5-ol |
| SMILES | COc1cc([C@H]2c3c(cc(C)c(O)c3C)[C@H](CCc3ccccc3)[C@@H]2C)ccc1O |
| InChI | InChI=1S/C27H30O3/c1-16-14-22-21(12-10-19-8-6-5-7-9-19)17(2)25(26(22)18(3)27(16)29)20-11-13-23(28)24(15-20)30-4/h5-9,11,13-15,17,21,25,28-29H,10,12H2,1-4H3/t17-,21+,25-/m0/s1 |
| InChIKey | XXSYOQRMLPQPEK-QBFCQJJASA-N |
| XLogP | 6.22 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |