C29H33NO7 — CID 159350803
tert-butyl 3-[3-[1-[2-(7,8-dihydroxy-2-oxochromen-4-yl)acetyl]piperidin-4-yl]phenyl]propanoate (PubChem CID 159350803) has the molecular formula C29H33NO7 and a molecular weight of 507.58 g/mol. Its IUPAC name is tert-butyl 3-[3-[1-[2-(7,8-dihydroxy-2-oxochromen-4-yl)acetyl]piperidin-4-yl]phenyl]propanoate.
| Compound Name | tert-butyl 3-[3-[1-[2-(7,8-dihydroxy-2-oxochromen-4-yl)acetyl]piperidin-4-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 159350803 |
| Molecular Formula | C29H33NO7 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | tert-butyl 3-[3-[1-[2-(7,8-dihydroxy-2-oxochromen-4-yl)acetyl]piperidin-4-yl]phenyl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1cccc(C2CCN(C(=O)Cc3cc(=O)oc4c(O)c(O)ccc34)CC2)c1 |
| InChI | InChI=1S/C29H33NO7/c1-29(2,3)37-25(33)10-7-18-5-4-6-20(15-18)19-11-13-30(14-12-19)24(32)16-21-17-26(34)36-28-22(21)8-9-23(31)27(28)35/h4-6,8-9,15,17,19,31,35H,7,10-14,16H2,1-3H3 |
| InChIKey | LHHKEFQCYIFHBB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|