C32H32O6 — CID 159350838
ethyl 2-(4-hydroxyphenyl)-2-phenylacetate;2-(4-hydroxyphenyl)-2-phenylbutanoic acid (PubChem CID 159350838) has the molecular formula C32H32O6 and a molecular weight of 512.60 g/mol. Its IUPAC name is ethyl 2-(4-hydroxyphenyl)-2-phenylacetate;2-(4-hydroxyphenyl)-2-phenylbutanoic acid.
| Compound Name | ethyl 2-(4-hydroxyphenyl)-2-phenylacetate;2-(4-hydroxyphenyl)-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 159350838 |
| Molecular Formula | C32H32O6 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | ethyl 2-(4-hydroxyphenyl)-2-phenylacetate;2-(4-hydroxyphenyl)-2-phenylbutanoic acid |
| SMILES | CCC(C(=O)O)(c1ccccc1)c1ccc(O)cc1.CCOC(=O)C(c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/2C16H16O3/c1-2-16(15(18)19,12-6-4-3-5-7-12)13-8-10-14(17)11-9-13;1-2-19-16(18)15(12-6-4-3-5-7-12)13-8-10-14(17)11-9-13/h3-11,17H,2H2,1H3,(H,18,19);3-11,15,17H,2H2,1H3 |
| InChIKey | LHHOQWFPZFZXBX-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |