About methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate
methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate (PubChem CID 159350911) has the molecular formula C23H26BrNO6
and a molecular weight of 492.37 g/mol. Its IUPAC name is methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate.
Molecular Properties
| Compound Name | methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate |
| PubChem CID | 159350911 |
| Molecular Formula | C23H26BrNO6 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate |
| SMILES | COC(=O)c1ccc(OC(C)C)c(Br)c1.COC(=O)c1ccc(OC(C)C)c(C#N)c1 |
| InChI | InChI=1S/C12H13NO3.C11H13BrO3/c1-8(2)16-11-5-4-9(12(14)15-3)6-10(11)7-13;1-7(2)15-10-5-4-8(6-9(10)12)11(13)14-3/h4-6,8H,1-3H3;4-7H,1-3H3 |
| InChIKey | LHHTXZGLFCGZEU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate?
The IUPAC name of methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate (CID 159350911) is methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate.
What is the SMILES notation for methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate?
The canonical SMILES for methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate is COC(=O)c1ccc(OC(C)C)c(Br)c1.COC(=O)c1ccc(OC(C)C)c(C#N)c1.
What is the InChIKey of methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate?
The InChIKey is LHHTXZGLFCGZEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3.C11H13BrO3/c1-8(2)16-11-5-4-9(12(14)15-3)6-10(11)7-13;1-7(2)15-10-5-4-8(6-9(10)12)11(13)14-3/h4-6,8H,1-3H3;4-7H,1-3H3.
What are the key properties of methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate?
methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate has a molecular weight of 492.37 g/mol, XLogP of 5.15, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-4-propan-2-yloxybenzoate;methyl 3-cyano-4-propan-2-yloxybenzoate is sourced from PubChem (CID 159350911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).