C26H46O3Si — CID 159351008
(4S,5E)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctylidene]-4-[(Z)-7-hydroxyhept-2-enyl]cyclopent-2-en-1-one (PubChem CID 159351008) has the molecular formula C26H46O3Si and a molecular weight of 434.74 g/mol. Its IUPAC name is (4S,5E)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctylidene]-4-[(Z)-7-hydroxyhept-2-enyl]cyclopent-2-en-1-one.
| Compound Name | (4S,5E)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctylidene]-4-[(Z)-7-hydroxyhept-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 159351008 |
| Molecular Formula | C26H46O3Si |
| Molecular Weight | 434.74 g/mol |
| Exact Mass | 434.32 |
| IUPAC Name | (4S,5E)-5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctylidene]-4-[(Z)-7-hydroxyhept-2-enyl]cyclopent-2-en-1-one |
| SMILES | CCCCC[C@@H](C/C=C1/C(=O)C=C[C@@H]1C/C=C\CCCCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O3Si/c1-7-8-12-16-23(29-30(5,6)26(2,3)4)18-19-24-22(17-20-25(24)28)15-13-10-9-11-14-21-27/h10,13,17,19-20,22-23,27H,7-9,11-12,14-16,18,21H2,1-6H3/b13-10-,24-19+/t22-,23-/m0/s1 |
| InChIKey | LHIBGCDXLADIOP-PBKFALNLSA-N |
| XLogP | 7.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.74 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|