About N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide
N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide (PubChem CID 159351802) has the molecular formula C16H17F3N2O
and a molecular weight of 310.32 g/mol. Its IUPAC name is N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide.
Molecular Properties
| Compound Name | N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide |
| PubChem CID | 159351802 |
| Molecular Formula | C16H17F3N2O |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide |
| SMILES | O=C(N[C@H]1CCN(CCC(F)(F)F)C1)C1=C2C=CC=C2C=C1 |
| InChI | InChI=1S/C16H17F3N2O/c17-16(18,19)7-9-21-8-6-12(10-21)20-15(22)14-5-4-11-2-1-3-13(11)14/h1-5,12H,6-10H2,(H,20,22)/t12-/m0/s1 |
| InChIKey | LHKLELFZTOJAAU-LBPRGKRZSA-N |
| XLogP | 2.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide?
The IUPAC name of N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide (CID 159351802) is N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide.
What is the SMILES notation for N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide?
The canonical SMILES for N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide is O=C(N[C@H]1CCN(CCC(F)(F)F)C1)C1=C2C=CC=C2C=C1.
What is the InChIKey of N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide?
The InChIKey is LHKLELFZTOJAAU-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H17F3N2O/c17-16(18,19)7-9-21-8-6-12(10-21)20-15(22)14-5-4-11-2-1-3-13(11)14/h1-5,12H,6-10H2,(H,20,22)/t12-/m0/s1.
What are the key properties of N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide?
N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide has a molecular weight of 310.32 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]pentalene-1-carboxamide is sourced from PubChem (CID 159351802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).