About [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten
[1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten (PubChem CID 159351941) has the molecular formula C12H11N3OW
and a molecular weight of 397.08 g/mol. Its IUPAC name is [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten.
Molecular Properties
| Compound Name | [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten |
| PubChem CID | 159351941 |
| Molecular Formula | C12H11N3OW |
| Molecular Weight | 397.08 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten |
| SMILES | C=C(C=CC(=[W])C#N)c1nc(C)[nH]c(=O)c1C |
| InChI | InChI=1S/C12H11N3O.W/c1-8(6-4-5-7-13)11-9(2)12(16)15-10(3)14-11;/h4,6H,1H2,2-3H3,(H,14,15,16); |
| InChIKey | PTQYYWAWTYRFLR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.08 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten?
The IUPAC name of [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten (CID 159351941) is [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten.
What is the SMILES notation for [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten?
The canonical SMILES for [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten is C=C(C=CC(=[W])C#N)c1nc(C)[nH]c(=O)c1C.
What is the InChIKey of [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten?
The InChIKey is PTQYYWAWTYRFLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O.W/c1-8(6-4-5-7-13)11-9(2)12(16)15-10(3)14-11;/h4,6H,1H2,2-3H3,(H,14,15,16);.
What are the key properties of [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten?
[1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten has a molecular weight of 397.08 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-cyano-4-(2,5-dimethyl-6-oxo-1H-pyrimidin-4-yl)penta-2,4-dienylidene]tungsten is sourced from PubChem (CID 159351941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).