C25H32N2O5 — CID 159352234
(5S,9R,11Z,13R,14S)-10-hydroxy-7,7,13,14,18,21-hexamethyl-6,8,15-trioxa-21,23-diazatetracyclo[15.7.0.05,9.020,24]tetracosa-1(17),2,11,18,20(24),22-hexaen-16-one (PubChem CID 159352234) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is (5S,9R,11Z,13R,14S)-10-hydroxy-7,7,13,14,18,21-hexamethyl-6,8,15-trioxa-21,23-diazatetracyclo[15.7.0.05,9.020,24]tetracosa-1(17),2,11,18,20(24),22-hexaen-16-one.
| Compound Name | (5S,9R,11Z,13R,14S)-10-hydroxy-7,7,13,14,18,21-hexamethyl-6,8,15-trioxa-21,23-diazatetracyclo[15.7.0.05,9.020,24]tetracosa-1(17),2,11,18,20(24),22-hexaen-16-one |
|---|---|
| PubChem CID | 159352234 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (5S,9R,11Z,13R,14S)-10-hydroxy-7,7,13,14,18,21-hexamethyl-6,8,15-trioxa-21,23-diazatetracyclo[15.7.0.05,9.020,24]tetracosa-1(17),2,11,18,20(24),22-hexaen-16-one |
| SMILES | Cc1cc2c(ncn2C)c2c1C(=O)O[C@@H](C)[C@H](C)/C=C\C(O)[C@H]1OC(C)(C)O[C@H]1CC=C2 |
| InChI | InChI=1S/C25H32N2O5/c1-14-10-11-19(28)23-20(31-25(4,5)32-23)9-7-8-17-21(24(29)30-16(14)3)15(2)12-18-22(17)26-13-27(18)6/h7-8,10-14,16,19-20,23,28H,9H2,1-6H3/b8-7?,11-10-/t14-,16+,19?,20+,23-/m1/s1 |
| InChIKey | SAUJUBHTOFJEHU-QNIJGENASA-N |
| XLogP | 3.92 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|