C8H15BrN2 — CID 15935235
1-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-1-ium bromide (PubChem CID 15935235) has the molecular formula C8H15BrN2 and a molecular weight of 219.13 g/mol. Its IUPAC name is 1-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-1-ium bromide.
| Compound Name | 1-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-1-ium bromide |
|---|---|
| PubChem CID | 15935235 |
| Molecular Formula | C8H15BrN2 |
| Molecular Weight | 219.13 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 1-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-1-ium bromide |
| SMILES | C[N+]1=C2CCCN2CCC1.[Br-] |
| InChI | InChI=1S/C8H15N2.BrH/c1-9-5-3-7-10-6-2-4-8(9)10;/h2-7H2,1H3;1H/q+1;/p-1 |
| InChIKey | QCTPPKHYSWRUGU-UHFFFAOYSA-M |
| XLogP | -2.47 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.13 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|