C9H17N2+ — CID 15935238
1-ethyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium (PubChem CID 15935238) has the molecular formula C9H17N2+ and a molecular weight of 153.25 g/mol. Its IUPAC name is 1-ethyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium.
| Compound Name | 1-ethyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium |
|---|---|
| PubChem CID | 15935238 |
| Molecular Formula | C9H17N2+ |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.14 |
| IUPAC Name | 1-ethyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium |
| SMILES | CCN1CCC[N+]2=C1CCC2 |
| InChI | InChI=1S/C9H17N2/c1-2-10-7-4-8-11-6-3-5-9(10)11/h2-8H2,1H3/q+1 |
| InChIKey | JNYGNGJDBOXZRJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|