C27H26F3N5O3S — CID 159352785
(E)-N-[2-[4,6-difluoro-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]indol-3-yl]sulfonylethyl]-2-(methyliminomethyl)but-2-enamide (PubChem CID 159352785) has the molecular formula C27H26F3N5O3S and a molecular weight of 557.60 g/mol. Its IUPAC name is (E)-N-[2-[4,6-difluoro-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]indol-3-yl]sulfonylethyl]-2-(methyliminomethyl)but-2-enamide.
| Compound Name | (E)-N-[2-[4,6-difluoro-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]indol-3-yl]sulfonylethyl]-2-(methyliminomethyl)but-2-enamide |
|---|---|
| PubChem CID | 159352785 |
| Molecular Formula | C27H26F3N5O3S |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | (E)-N-[2-[4,6-difluoro-1-[[2-fluoro-4-(1-methylpyrazol-4-yl)phenyl]methyl]indol-3-yl]sulfonylethyl]-2-(methyliminomethyl)but-2-enamide |
| SMILES | C/C=C(\C=N\C)C(=O)NCCS(=O)(=O)c1cn(Cc2ccc(-c3cnn(C)c3)cc2F)c2cc(F)cc(F)c12 |
| InChI | InChI=1S/C27H26F3N5O3S/c1-4-17(12-31-2)27(36)32-7-8-39(37,38)25-16-35(24-11-21(28)10-23(30)26(24)25)15-19-6-5-18(9-22(19)29)20-13-33-34(3)14-20/h4-6,9-14,16H,7-8,15H2,1-3H3,(H,32,36)/b17-4+,31-12+ |
| InChIKey | LHNRYDLEQLGDEM-RIHIKLOESA-N |
| XLogP | 4.04 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|