About 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole
3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole (PubChem CID 159354506) has the molecular formula C18H34N2
and a molecular weight of 278.48 g/mol. Its IUPAC name is 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole.
Molecular Properties
| Compound Name | 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole |
| PubChem CID | 159354506 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole |
| SMILES | CCC(C)C1CCNC1C.Cc1cc[nH]c1CC(C)C |
| InChI | InChI=1S/C9H15N.C9H19N/c1-7(2)6-9-8(3)4-5-10-9;1-4-7(2)9-5-6-10-8(9)3/h4-5,7,10H,6H2,1-3H3;7-10H,4-6H2,1-3H3 |
| InChIKey | LHTHLAISUCXPNX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole?
The IUPAC name of 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole (CID 159354506) is 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole.
What is the SMILES notation for 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole?
The canonical SMILES for 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole is CCC(C)C1CCNC1C.Cc1cc[nH]c1CC(C)C.
What is the InChIKey of 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole?
The InChIKey is LHTHLAISUCXPNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N.C9H19N/c1-7(2)6-9-8(3)4-5-10-9;1-4-7(2)9-5-6-10-8(9)3/h4-5,7,10H,6H2,1-3H3;7-10H,4-6H2,1-3H3.
What are the key properties of 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole?
3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole has a molecular weight of 278.48 g/mol, XLogP of 4.55, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-2-methylpyrrolidine;3-methyl-2-(2-methylpropyl)-1H-pyrrole is sourced from PubChem (CID 159354506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).