C25H26BBrN2O4 — CID 159355721
7-bromo-1-methylquinolin-2-one;7-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methylquinolin-2-one (PubChem CID 159355721) has the molecular formula C25H26BBrN2O4 and a molecular weight of 509.21 g/mol. Its IUPAC name is 7-bromo-1-methylquinolin-2-one;7-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methylquinolin-2-one.
| Compound Name | 7-bromo-1-methylquinolin-2-one;7-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 159355721 |
| Molecular Formula | C25H26BBrN2O4 |
| Molecular Weight | 509.21 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 7-bromo-1-methylquinolin-2-one;7-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)ccc2ccc(B3OCC(C)(C)CO3)cc21.Cn1c(=O)ccc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H18BNO3.C10H8BrNO/c1-15(2)9-19-16(20-10-15)12-6-4-11-5-7-14(18)17(3)13(11)8-12;1-12-9-6-8(11)4-2-7(9)3-5-10(12)13/h4-8H,9-10H2,1-3H3;2-6H,1H3 |
| InChIKey | LHWXKXMLZFXEOT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.21 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|