hydrazine;nitric acid

H9N5O3 — CID 159356291

IUPAChydrazine;nitric acid
SMILESNN.NN.O=[N+]([O-])O
InChIInChI=1S/2H4N2.HNO3/c2*1-2;2-1(3)4/h2*1-2H2;(H,2,3,4)
InChIKeyLHYPTHFPISQQIS-UHFFFAOYSA-N
MW127.10 g/mol
LogP-2.71
Rot. Bonds

About hydrazine;nitric acid

hydrazine;nitric acid (PubChem CID 159356291) has the molecular formula H9N5O3 and a molecular weight of 127.10 g/mol. Its IUPAC name is hydrazine;nitric acid.

Molecular Properties

Compound Namehydrazine;nitric acid
PubChem CID159356291
Molecular FormulaH9N5O3
Molecular Weight127.10 g/mol
Exact Mass127.07
IUPAC Namehydrazine;nitric acid
SMILESNN.NN.O=[N+]([O-])O
InChIInChI=1S/2H4N2.HNO3/c2*1-2;2-1(3)4/h2*1-2H2;(H,2,3,4)
InChIKeyLHYPTHFPISQQIS-UHFFFAOYSA-N
XLogP-2.71
TPSA167.45 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.10
LogP ≤ 5-2.71
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze hydrazine;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrazine;nitric acid?
The IUPAC name of hydrazine;nitric acid (CID 159356291) is hydrazine;nitric acid.
What is the SMILES notation for hydrazine;nitric acid?
The canonical SMILES for hydrazine;nitric acid is NN.NN.O=[N+]([O-])O.
What is the InChIKey of hydrazine;nitric acid?
The InChIKey is LHYPTHFPISQQIS-UHFFFAOYSA-N. The full InChI is InChI=1S/2H4N2.HNO3/c2*1-2;2-1(3)4/h2*1-2H2;(H,2,3,4).
What are the key properties of hydrazine;nitric acid?
hydrazine;nitric acid has a molecular weight of 127.10 g/mol, XLogP of -2.71, 0 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;nitric acid is sourced from PubChem (CID 159356291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).