About 1-bromo-4-methylbenzene;2,3-dihydrofuran
1-bromo-4-methylbenzene;2,3-dihydrofuran (PubChem CID 159356760) has the molecular formula C11H13BrO
and a molecular weight of 241.13 g/mol. Its IUPAC name is 1-bromo-4-methylbenzene;2,3-dihydrofuran.
Molecular Properties
| Compound Name | 1-bromo-4-methylbenzene;2,3-dihydrofuran |
| PubChem CID | 159356760 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 1-bromo-4-methylbenzene;2,3-dihydrofuran |
| SMILES | C1=COCC1.Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C7H7Br.C4H6O/c1-6-2-4-7(8)5-3-6;1-2-4-5-3-1/h2-5H,1H3;1,3H,2,4H2 |
| InChIKey | LIADRYUDICTXQN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-methylbenzene;2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methylbenzene;2,3-dihydrofuran?
The IUPAC name of 1-bromo-4-methylbenzene;2,3-dihydrofuran (CID 159356760) is 1-bromo-4-methylbenzene;2,3-dihydrofuran.
What is the SMILES notation for 1-bromo-4-methylbenzene;2,3-dihydrofuran?
The canonical SMILES for 1-bromo-4-methylbenzene;2,3-dihydrofuran is C1=COCC1.Cc1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-methylbenzene;2,3-dihydrofuran?
The InChIKey is LIADRYUDICTXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Br.C4H6O/c1-6-2-4-7(8)5-3-6;1-2-4-5-3-1/h2-5H,1H3;1,3H,2,4H2.
What are the key properties of 1-bromo-4-methylbenzene;2,3-dihydrofuran?
1-bromo-4-methylbenzene;2,3-dihydrofuran has a molecular weight of 241.13 g/mol, XLogP of 3.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methylbenzene;2,3-dihydrofuran is sourced from PubChem (CID 159356760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).