C16H19N5O3S2 — CID 159357860
3-amino-N-(2-amino-2-sulfanylideneethyl)-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboxamide (PubChem CID 159357860) has the molecular formula C16H19N5O3S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-amino-N-(2-amino-2-sulfanylideneethyl)-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-(2-amino-2-sulfanylideneethyl)-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 159357860 |
| Molecular Formula | C16H19N5O3S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 3-amino-N-(2-amino-2-sulfanylideneethyl)-6-(4-propan-2-ylsulfonylphenyl)pyrazine-2-carboxamide |
| SMILES | CC(C)S(=O)(=O)c1ccc(-c2cnc(N)c(C(=O)NCC(N)=S)n2)cc1 |
| InChI | InChI=1S/C16H19N5O3S2/c1-9(2)26(23,24)11-5-3-10(4-6-11)12-7-19-15(18)14(21-12)16(22)20-8-13(17)25/h3-7,9H,8H2,1-2H3,(H2,17,25)(H2,18,19)(H,20,22) |
| InChIKey | SGFLHRWDVIQXCA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|