About 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole
2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole (PubChem CID 159358183) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole.
Molecular Properties
| Compound Name | 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole |
| PubChem CID | 159358183 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole |
| SMILES | CC(C)c1ccco1.CC(C)c1ccon1 |
| InChI | InChI=1S/C7H10O.C6H9NO/c1-6(2)7-4-3-5-8-7;1-5(2)6-3-4-8-7-6/h3-6H,1-2H3;3-5H,1-2H3 |
| InChIKey | LIEQLBMBIWCUFF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole?
The IUPAC name of 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole (CID 159358183) is 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole.
What is the SMILES notation for 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole?
The canonical SMILES for 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole is CC(C)c1ccco1.CC(C)c1ccon1.
What is the InChIKey of 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole?
The InChIKey is LIEQLBMBIWCUFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.C6H9NO/c1-6(2)7-4-3-5-8-7;1-5(2)6-3-4-8-7-6/h3-6H,1-2H3;3-5H,1-2H3.
What are the key properties of 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole?
2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole has a molecular weight of 221.30 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylfuran;3-propan-2-yl-1,2-oxazole is sourced from PubChem (CID 159358183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).