C10H14N2 — CID 15936105
1-N,4-N-diethylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 15936105) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1-N,4-N-diethylcyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 1-N,4-N-diethylcyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 15936105 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1-N,4-N-diethylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | CCN=C1C=CC(=NCC)C=C1 |
| InChI | InChI=1S/C10H14N2/c1-3-11-9-5-7-10(8-6-9)12-4-2/h5-8H,3-4H2,1-2H3/b11-9-,12-10+ |
| InChIKey | ILJWICYGTNRVBW-DSOJMZEYSA-N |
| XLogP | 2.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|