About 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one
5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one (PubChem CID 159361539) has the molecular formula C21H18Br2N2O2
and a molecular weight of 490.20 g/mol. Its IUPAC name is 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one |
| PubChem CID | 159361539 |
| Molecular Formula | C21H18Br2N2O2 |
| Molecular Weight | 490.20 g/mol |
| Exact Mass | 487.97 |
| IUPAC Name | 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2[nH]c(=O)ccc2c1Br.Cc1ccc2c(ccc(=O)n2C)c1Br |
| InChI | InChI=1S/C11H10BrNO.C10H8BrNO/c1-7-3-5-9-8(11(7)12)4-6-10(14)13(9)2;1-6-2-4-8-7(10(6)11)3-5-9(13)12-8/h3-6H,1-2H3;2-5H,1H3,(H,12,13) |
| InChIKey | LIPJTEQLEWGEAK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.20 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one?
The IUPAC name of 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one (CID 159361539) is 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one.
What is the SMILES notation for 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one?
The canonical SMILES for 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one is Cc1ccc2[nH]c(=O)ccc2c1Br.Cc1ccc2c(ccc(=O)n2C)c1Br.
What is the InChIKey of 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one?
The InChIKey is LIPJTEQLEWGEAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrNO.C10H8BrNO/c1-7-3-5-9-8(11(7)12)4-6-10(14)13(9)2;1-6-2-4-8-7(10(6)11)3-5-9(13)12-8/h3-6H,1-2H3;2-5H,1H3,(H,12,13).
What are the key properties of 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one?
5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one has a molecular weight of 490.20 g/mol, XLogP of 5.21, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,6-dimethylquinolin-2-one;5-bromo-6-methyl-1H-quinolin-2-one is sourced from PubChem (CID 159361539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).