C16H5F21O4S — CID 15936168
2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecoxy)benzenesulfonic acid (PubChem CID 15936168) has the molecular formula C16H5F21O4S and a molecular weight of 692.24 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecoxy)benzenesulfonic acid.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 15936168 |
| Molecular Formula | C16H5F21O4S |
| Molecular Weight | 692.24 g/mol |
| Exact Mass | 691.96 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecoxy)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H5F21O4S/c17-7(18,9(21,22)11(25,26)13(29,30)15(33,34)35)8(19,20)10(23,24)12(27,28)14(31,32)16(36,37)41-5-3-1-2-4-6(5)42(38,39)40/h1-4H,(H,38,39,40) |
| InChIKey | BIABXCAIJSHKJR-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.24 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|