C14H20F13N2O5S2+ — CID 15936193
dimethyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propyl]azanium (PubChem CID 15936193) has the molecular formula C14H20F13N2O5S2+ and a molecular weight of 607.43 g/mol. Its IUPAC name is dimethyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propyl]azanium.
| Compound Name | dimethyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propyl]azanium |
|---|---|
| PubChem CID | 15936193 |
| Molecular Formula | C14H20F13N2O5S2+ |
| Molecular Weight | 607.43 g/mol |
| Exact Mass | 607.06 |
| IUPAC Name | dimethyl-(3-sulfopropyl)-[3-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonylamino)propyl]azanium |
| SMILES | C[N+](C)(CCCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C14H19F13N2O5S2/c1-29(2,7-4-8-35(30,31)32)6-3-5-28-36(33,34)14(26,27)12(21,22)10(17,18)9(15,16)11(19,20)13(23,24)25/h28H,3-8H2,1-2H3/p+1 |
| InChIKey | HQZMVHMXSNFQPY-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|