C17H22F13N2O6S+ — CID 15936195
2-carboxyethyl-[3-[2-carboxyethyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]propyl]-dimethylazanium (PubChem CID 15936195) has the molecular formula C17H22F13N2O6S+ and a molecular weight of 629.41 g/mol. Its IUPAC name is 2-carboxyethyl-[3-[2-carboxyethyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]propyl]-dimethylazanium.
| Compound Name | 2-carboxyethyl-[3-[2-carboxyethyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 15936195 |
| Molecular Formula | C17H22F13N2O6S+ |
| Molecular Weight | 629.41 g/mol |
| Exact Mass | 629.10 |
| IUPAC Name | 2-carboxyethyl-[3-[2-carboxyethyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)amino]propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCN(CCC(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(=O)O |
| InChI | InChI=1S/C17H21F13N2O6S/c1-32(2,9-5-11(35)36)8-3-6-31(7-4-10(33)34)39(37,38)17(29,30)15(24,25)13(20,21)12(18,19)14(22,23)16(26,27)28/h3-9H2,1-2H3,(H-,33,34,35,36)/p+1 |
| InChIKey | SFCBLTGKAPVNIN-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|