C12H19Cl5N6+2 — CID 159363106
bis(3-methyl-1H-imidazol-3-ium);2,2,3,4,4-pentachloro-1-methylimidazolidine (PubChem CID 159363106) has the molecular formula C12H19Cl5N6+2 and a molecular weight of 424.59 g/mol. Its IUPAC name is bis(3-methyl-1H-imidazol-3-ium);2,2,3,4,4-pentachloro-1-methylimidazolidine.
| Compound Name | bis(3-methyl-1H-imidazol-3-ium);2,2,3,4,4-pentachloro-1-methylimidazolidine |
|---|---|
| PubChem CID | 159363106 |
| Molecular Formula | C12H19Cl5N6+2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | bis(3-methyl-1H-imidazol-3-ium);2,2,3,4,4-pentachloro-1-methylimidazolidine |
| SMILES | CN1CC(Cl)(Cl)N(Cl)C1(Cl)Cl.C[n+]1cc[nH]c1.C[n+]1cc[nH]c1 |
| InChI | InChI=1S/C4H5Cl5N2.2C4H6N2/c1-10-2-3(5,6)11(9)4(10,7)8;2*1-6-3-2-5-4-6/h2H2,1H3;2*2-4H,1H3/p+2 |
| InChIKey | LIUBBFBRFUAUEG-UHFFFAOYSA-P |
| XLogP | 2.29 |
| TPSA | 45.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|