C4H10N8O2 — CID 159363516
N-(4,6-diamino-1,3,5-triazin-2-yl)hydroxylamine;urea (PubChem CID 159363516) has the molecular formula C4H10N8O2 and a molecular weight of 202.18 g/mol. Its IUPAC name is N-(4,6-diamino-1,3,5-triazin-2-yl)hydroxylamine;urea.
| Compound Name | N-(4,6-diamino-1,3,5-triazin-2-yl)hydroxylamine;urea |
|---|---|
| PubChem CID | 159363516 |
| Molecular Formula | C4H10N8O2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | N-(4,6-diamino-1,3,5-triazin-2-yl)hydroxylamine;urea |
| SMILES | NC(N)=O.Nc1nc(N)nc(NO)n1 |
| InChI | InChI=1S/C3H6N6O.CH4N2O/c4-1-6-2(5)8-3(7-1)9-10;2-1(3)4/h10H,(H5,4,5,6,7,8,9);(H4,2,3,4) |
| InChIKey | LIVFHZPMGCYMSB-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 192.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|