C16H19F2N2O3+ — CID 159364575
6-(2,2-difluoropropoxy)-3-(3-ethyl-1-hydroxypyridin-1-ium-2-yl)-1-methylpyridin-2-one (PubChem CID 159364575) has the molecular formula C16H19F2N2O3+ and a molecular weight of 325.34 g/mol. Its IUPAC name is 6-(2,2-difluoropropoxy)-3-(3-ethyl-1-hydroxypyridin-1-ium-2-yl)-1-methylpyridin-2-one.
| Compound Name | 6-(2,2-difluoropropoxy)-3-(3-ethyl-1-hydroxypyridin-1-ium-2-yl)-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 159364575 |
| Molecular Formula | C16H19F2N2O3+ |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 6-(2,2-difluoropropoxy)-3-(3-ethyl-1-hydroxypyridin-1-ium-2-yl)-1-methylpyridin-2-one |
| SMILES | CCc1ccc[n+](O)c1-c1ccc(OCC(C)(F)F)n(C)c1=O |
| InChI | InChI=1S/C16H19F2N2O3/c1-4-11-6-5-9-20(22)14(11)12-7-8-13(19(3)15(12)21)23-10-16(2,17)18/h5-9,22H,4,10H2,1-3H3/q+1 |
| InChIKey | LAHFTMVPVXVJLQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|