About 2-hydroperoxy-2-methylpropane;2-phenyloxirane
2-hydroperoxy-2-methylpropane;2-phenyloxirane (PubChem CID 159367370) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-hydroperoxy-2-methylpropane;2-phenyloxirane.
Molecular Properties
| Compound Name | 2-hydroperoxy-2-methylpropane;2-phenyloxirane |
| PubChem CID | 159367370 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-hydroperoxy-2-methylpropane;2-phenyloxirane |
| SMILES | CC(C)(C)OO.c1ccc(C2CO2)cc1 |
| InChI | InChI=1S/C8H8O.C4H10O2/c1-2-4-7(5-3-1)8-6-9-8;1-4(2,3)6-5/h1-5,8H,6H2;5H,1-3H3 |
| InChIKey | LJHMNNQWXOZLFE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroperoxy-2-methylpropane;2-phenyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroperoxy-2-methylpropane;2-phenyloxirane?
The IUPAC name of 2-hydroperoxy-2-methylpropane;2-phenyloxirane (CID 159367370) is 2-hydroperoxy-2-methylpropane;2-phenyloxirane.
What is the SMILES notation for 2-hydroperoxy-2-methylpropane;2-phenyloxirane?
The canonical SMILES for 2-hydroperoxy-2-methylpropane;2-phenyloxirane is CC(C)(C)OO.c1ccc(C2CO2)cc1.
What is the InChIKey of 2-hydroperoxy-2-methylpropane;2-phenyloxirane?
The InChIKey is LJHMNNQWXOZLFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C4H10O2/c1-2-4-7(5-3-1)8-6-9-8;1-4(2,3)6-5/h1-5,8H,6H2;5H,1-3H3.
What are the key properties of 2-hydroperoxy-2-methylpropane;2-phenyloxirane?
2-hydroperoxy-2-methylpropane;2-phenyloxirane has a molecular weight of 210.27 g/mol, XLogP of 3.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroperoxy-2-methylpropane;2-phenyloxirane is sourced from PubChem (CID 159367370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).