About N,3-dimethyloxirane-2-carboxamide;ethene
N,3-dimethyloxirane-2-carboxamide;ethene (PubChem CID 159367774) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is N,3-dimethyloxirane-2-carboxamide;ethene.
Molecular Properties
| Compound Name | N,3-dimethyloxirane-2-carboxamide;ethene |
| PubChem CID | 159367774 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N,3-dimethyloxirane-2-carboxamide;ethene |
| SMILES | C=C.CNC(=O)C1OC1C |
| InChI | InChI=1S/C5H9NO2.C2H4/c1-3-4(8-3)5(7)6-2;1-2/h3-4H,1-2H3,(H,6,7);1-2H2 |
| InChIKey | LJISBJMQQWNVBS-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethyloxirane-2-carboxamide;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyloxirane-2-carboxamide;ethene?
The IUPAC name of N,3-dimethyloxirane-2-carboxamide;ethene (CID 159367774) is N,3-dimethyloxirane-2-carboxamide;ethene.
What is the SMILES notation for N,3-dimethyloxirane-2-carboxamide;ethene?
The canonical SMILES for N,3-dimethyloxirane-2-carboxamide;ethene is C=C.CNC(=O)C1OC1C.
What is the InChIKey of N,3-dimethyloxirane-2-carboxamide;ethene?
The InChIKey is LJISBJMQQWNVBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.C2H4/c1-3-4(8-3)5(7)6-2;1-2/h3-4H,1-2H3,(H,6,7);1-2H2.
What are the key properties of N,3-dimethyloxirane-2-carboxamide;ethene?
N,3-dimethyloxirane-2-carboxamide;ethene has a molecular weight of 143.19 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyloxirane-2-carboxamide;ethene is sourced from PubChem (CID 159367774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).