C30H36BClF2N6O2 — CID 159367785
(6-chloro-5-fluoro-3-pyridinyl)methanamine;[5-fluoro-6-(2-methyl-4-pyridinyl)-3-pyridinyl]methanamine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 159367785) has the molecular formula C30H36BClF2N6O2 and a molecular weight of 596.92 g/mol. Its IUPAC name is (6-chloro-5-fluoro-3-pyridinyl)methanamine;[5-fluoro-6-(2-methyl-4-pyridinyl)-3-pyridinyl]methanamine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | (6-chloro-5-fluoro-3-pyridinyl)methanamine;[5-fluoro-6-(2-methyl-4-pyridinyl)-3-pyridinyl]methanamine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 159367785 |
| Molecular Formula | C30H36BClF2N6O2 |
| Molecular Weight | 596.92 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | (6-chloro-5-fluoro-3-pyridinyl)methanamine;[5-fluoro-6-(2-methyl-4-pyridinyl)-3-pyridinyl]methanamine;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | Cc1cc(-c2ncc(CN)cc2F)ccn1.Cc1cc(B2OC(C)(C)C(C)(C)O2)ccn1.NCc1cnc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H18BNO2.C12H12FN3.C6H6ClFN2/c1-9-8-10(6-7-14-9)13-15-11(2,3)12(4,5)16-13;1-8-4-10(2-3-15-8)12-11(13)5-9(6-14)7-16-12;7-6-5(8)1-4(2-9)3-10-6/h6-8H,1-5H3;2-5,7H,6,14H2,1H3;1,3H,2,9H2 |
| InChIKey | LJISTCCNPLSDJU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.92 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|