C51H105N3 — CID 159369301
1,2,3-tritert-butylazepane;1,2,3-tritert-butylpiperidine;1,2,3-tritert-butylpyrrolidine (PubChem CID 159369301) has the molecular formula C51H105N3 and a molecular weight of 760.42 g/mol. Its IUPAC name is 1,2,3-tritert-butylazepane;1,2,3-tritert-butylpiperidine;1,2,3-tritert-butylpyrrolidine.
| Compound Name | 1,2,3-tritert-butylazepane;1,2,3-tritert-butylpiperidine;1,2,3-tritert-butylpyrrolidine |
|---|---|
| PubChem CID | 159369301 |
| Molecular Formula | C51H105N3 |
| Molecular Weight | 760.42 g/mol |
| Exact Mass | 759.83 |
| IUPAC Name | 1,2,3-tritert-butylazepane;1,2,3-tritert-butylpiperidine;1,2,3-tritert-butylpyrrolidine |
| SMILES | CC(C)(C)C1CCCCN(C(C)(C)C)C1C(C)(C)C.CC(C)(C)C1CCCN(C(C)(C)C)C1C(C)(C)C.CC(C)(C)C1CCN(C(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C18H37N.C17H35N.C16H33N/c1-16(2,3)14-12-10-11-13-19(18(7,8)9)15(14)17(4,5)6;1-15(2,3)13-11-10-12-18(17(7,8)9)14(13)16(4,5)6;1-14(2,3)12-10-11-17(16(7,8)9)13(12)15(4,5)6/h14-15H,10-13H2,1-9H3;13-14H,10-12H2,1-9H3;12-13H,10-11H2,1-9H3 |
| InChIKey | LJNQYYLZHKWQKS-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.42 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |