C25H24N2O5 — CID 159369422
3-acetyl-4-hydroxy-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-2-(4-methylphenyl)-2H-pyrrol-5-one;carbon dioxide (PubChem CID 159369422) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-acetyl-4-hydroxy-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-2-(4-methylphenyl)-2H-pyrrol-5-one;carbon dioxide.
| Compound Name | 3-acetyl-4-hydroxy-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-2-(4-methylphenyl)-2H-pyrrol-5-one;carbon dioxide |
|---|---|
| PubChem CID | 159369422 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 3-acetyl-4-hydroxy-1-[2-(2-methyl-1H-indol-3-yl)ethyl]-2-(4-methylphenyl)-2H-pyrrol-5-one;carbon dioxide |
| SMILES | CC(=O)C1=C(O)C(=O)N(CCc2c(C)[nH]c3ccccc23)C1c1ccc(C)cc1.O=C=O |
| InChI | InChI=1S/C24H24N2O3.CO2/c1-14-8-10-17(11-9-14)22-21(16(3)27)23(28)24(29)26(22)13-12-18-15(2)25-20-7-5-4-6-19(18)20;2-1-3/h4-11,22,25,28H,12-13H2,1-3H3; |
| InChIKey | LJOAXQPSIXATKK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|