C12H19F2NO2 — CID 159369424
methyl 2-(1-tert-butyl-3,3-difluoropiperidin-4-ylidene)acetate (PubChem CID 159369424) has the molecular formula C12H19F2NO2 and a molecular weight of 247.28 g/mol. Its IUPAC name is methyl 2-(1-tert-butyl-3,3-difluoropiperidin-4-ylidene)acetate.
| Compound Name | methyl 2-(1-tert-butyl-3,3-difluoropiperidin-4-ylidene)acetate |
|---|---|
| PubChem CID | 159369424 |
| Molecular Formula | C12H19F2NO2 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | methyl 2-(1-tert-butyl-3,3-difluoropiperidin-4-ylidene)acetate |
| SMILES | COC(=O)C=C1CCN(C(C)(C)C)CC1(F)F |
| InChI | InChI=1S/C12H19F2NO2/c1-11(2,3)15-6-5-9(7-10(16)17-4)12(13,14)8-15/h7H,5-6,8H2,1-4H3 |
| InChIKey | LJOBGNRECZJIOC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|