C24H41F4NO11 — CID 159369775
3-[3-[2-[[2-[2-[4-(3-but-3-enoxy-2-hydroxypropoxy)-2-hydroxybutoxy]-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]propanenitrile (PubChem CID 159369775) has the molecular formula C24H41F4NO11 and a molecular weight of 595.58 g/mol. Its IUPAC name is 3-[3-[2-[[2-[2-[4-(3-but-3-enoxy-2-hydroxypropoxy)-2-hydroxybutoxy]-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]propanenitrile.
| Compound Name | 3-[3-[2-[[2-[2-[4-(3-but-3-enoxy-2-hydroxypropoxy)-2-hydroxybutoxy]-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]propanenitrile |
|---|---|
| PubChem CID | 159369775 |
| Molecular Formula | C24H41F4NO11 |
| Molecular Weight | 595.58 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 3-[3-[2-[[2-[2-[4-(3-but-3-enoxy-2-hydroxypropoxy)-2-hydroxybutoxy]-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-2-hydroxypropoxy]propanenitrile |
| SMILES | C=CCCOCC(O)COCCC(O)COCC(F)(F)OC(F)(F)COCOCCOCC(O)COCCC#N |
| InChI | InChI=1S/C24H41F4NO11/c1-2-3-7-33-13-21(31)15-35-9-5-20(30)12-38-17-23(25,26)40-24(27,28)18-39-19-37-11-10-36-16-22(32)14-34-8-4-6-29/h2,20-22,30-32H,1,3-5,7-19H2 |
| InChIKey | LJOZWMBMUSNVOP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 158.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.58 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|