C17H27NO — CID 15937139
6,8-ditert-butyl-3-methyl-2,4-dihydro-1,3-benzoxazine (PubChem CID 15937139) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 6,8-ditert-butyl-3-methyl-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 6,8-ditert-butyl-3-methyl-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 15937139 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 6,8-ditert-butyl-3-methyl-2,4-dihydro-1,3-benzoxazine |
| SMILES | CN1COc2c(cc(C(C)(C)C)cc2C(C)(C)C)C1 |
| InChI | InChI=1S/C17H27NO/c1-16(2,3)13-8-12-10-18(7)11-19-15(12)14(9-13)17(4,5)6/h8-9H,10-11H2,1-7H3 |
| InChIKey | IUKSTIPRSHIEOI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'tert_butyl_A(2)', 'substructure': 'N/A'} |
|---|