C43H28N5O2Si — CID 159372425
CID 159372425 (PubChem CID 159372425) has the molecular formula C43H28N5O2Si and a molecular weight of 674.82 g/mol.
| Compound Name | CID 159372425 |
|---|---|
| PubChem CID | 159372425 |
| Molecular Formula | C43H28N5O2Si |
| Molecular Weight | 674.82 g/mol |
| Exact Mass | 674.20 |
| IUPAC Name | — |
| SMILES | C1=CC2c3ccc4oc(-n5c6ccccc6c6ccc(-c7cccc8ocnc78)nc65)nc4c3N([Si](c3ccccc3)c3ccccc3)C2C=C1 |
| InChI | InChI=1S/C43H28N5O2Si/c1-3-12-27(13-4-1)51(28-14-5-2-6-15-28)48-36-20-10-8-16-29(36)31-23-25-38-40(41(31)48)46-43(50-38)47-35-19-9-7-17-30(35)32-22-24-34(45-42(32)47)33-18-11-21-37-39(33)44-26-49-37/h1-26,29,36H |
| InChIKey | XNZINXZXYJWGER-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.82 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|