About CID 159374331
CID 159374331 (PubChem CID 159374331) has the molecular formula C30H36BBrN13O2S
and a molecular weight of 733.49 g/mol.
Molecular Properties
| Compound Name | CID 159374331 |
| PubChem CID | 159374331 |
| Molecular Formula | C30H36BBrN13O2S |
| Molecular Weight | 733.49 g/mol |
| Exact Mass | 732.21 |
| IUPAC Name | — |
| SMILES | Brc1ccc2c(/N=C3/CC4(CN5CCC4CC5)ON3)ncnn12.[B]=NS.c1cc2c(/N=C3/CC4(CN5CCC4CC5)ON3)ncnn2c1 |
| InChI | InChI=1S/C15H17BrN6O.C15H18N6O.BHNS/c16-12-2-1-11-14(17-9-18-22(11)12)19-13-7-15(23-20-13)8-21-5-3-10(15)4-6-21;1-2-12-14(16-10-17-21(12)5-1)18-13-8-15(22-19-13)9-20-6-3-11(15)4-7-20;1-2-3/h1-2,9-10H,3-8H2,(H,17,18,19,20);1-2,5,10-11H,3-4,6-9H2,(H,16,17,18,19);3H |
| InChIKey | HHHUQSNQPZTXIZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 733.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 159374331 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159374331?
The IUPAC name of CID 159374331 (CID 159374331) is not available.
What is the SMILES notation for CID 159374331?
The canonical SMILES for CID 159374331 is Brc1ccc2c(/N=C3/CC4(CN5CCC4CC5)ON3)ncnn12.[B]=NS.c1cc2c(/N=C3/CC4(CN5CCC4CC5)ON3)ncnn2c1.
What is the InChIKey of CID 159374331?
The InChIKey is HHHUQSNQPZTXIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrN6O.C15H18N6O.BHNS/c16-12-2-1-11-14(17-9-18-22(11)12)19-13-7-15(23-20-13)8-21-5-3-10(15)4-6-21;1-2-12-14(16-10-17-21(12)5-1)18-13-8-15(22-19-13)9-20-6-3-11(15)4-7-20;1-2-3/h1-2,9-10H,3-8H2,(H,17,18,19,20);1-2,5,10-11H,3-4,6-9H2,(H,16,17,18,19);3H.
What are the key properties of CID 159374331?
CID 159374331 has a molecular weight of 733.49 g/mol, XLogP of 3.24, 2 rotatable bonds, 3 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159374331 is sourced from PubChem (CID 159374331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).