About N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide
N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide (PubChem CID 159374595) has the molecular formula C18H32N2O2
and a molecular weight of 308.47 g/mol. Its IUPAC name is N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide.
Molecular Properties
| Compound Name | N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide |
| PubChem CID | 159374595 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)CCCN(CCNC(=O)C(=C)C)CC(C)(C)C |
| InChI | InChI=1S/C18H32N2O2/c1-14(2)16(21)9-8-11-20(13-18(5,6)7)12-10-19-17(22)15(3)4/h1,3,8-13H2,2,4-7H3,(H,19,22) |
| InChIKey | MXJLYVSWKCVXJY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide?
The IUPAC name of N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide (CID 159374595) is N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide.
What is the SMILES notation for N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide?
The canonical SMILES for N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide is C=C(C)C(=O)CCCN(CCNC(=O)C(=C)C)CC(C)(C)C.
What is the InChIKey of N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide?
The InChIKey is MXJLYVSWKCVXJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O2/c1-14(2)16(21)9-8-11-20(13-18(5,6)7)12-10-19-17(22)15(3)4/h1,3,8-13H2,2,4-7H3,(H,19,22).
What are the key properties of N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide?
N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide has a molecular weight of 308.47 g/mol, XLogP of 2.95, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2,2-dimethylpropyl-(5-methyl-4-oxohex-5-enyl)amino]ethyl]-2-methylprop-2-enamide is sourced from PubChem (CID 159374595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).