C14H15N5O4 — CID 159374840
methyl 5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]pyridine-2-carboxylate (PubChem CID 159374840) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is methyl 5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]pyridine-2-carboxylate.
| Compound Name | methyl 5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 159374840 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | methyl 5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]pyridine-2-carboxylate |
| SMILES | [H]/N=C1\N=C(N)CC(O)=C1CC(=O)Nc1ccc(C(=O)OC)nc1 |
| InChI | InChI=1S/C14H15N5O4/c1-23-14(22)9-3-2-7(6-17-9)18-12(21)4-8-10(20)5-11(15)19-13(8)16/h2-3,6,20H,4-5H2,1H3,(H,18,21)(H3,15,16,19) |
| InChIKey | RQCQSQFOKNFFMQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|