C19H16N2O5 — CID 159375777
9b-amino-4b-hydroxy-7-[(1S,2R)-2-methylcyclopropyl]-4-nitroindeno[1,2-b][1]benzofuran-10-one (PubChem CID 159375777) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is 9b-amino-4b-hydroxy-7-[(1S,2R)-2-methylcyclopropyl]-4-nitroindeno[1,2-b][1]benzofuran-10-one.
| Compound Name | 9b-amino-4b-hydroxy-7-[(1S,2R)-2-methylcyclopropyl]-4-nitroindeno[1,2-b][1]benzofuran-10-one |
|---|---|
| PubChem CID | 159375777 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 9b-amino-4b-hydroxy-7-[(1S,2R)-2-methylcyclopropyl]-4-nitroindeno[1,2-b][1]benzofuran-10-one |
| SMILES | C[C@@H]1C[C@@H]1c1ccc2c(c1)OC1(O)c3c(cccc3[N+](=O)[O-])C(=O)C21N |
| InChI | InChI=1S/C19H16N2O5/c1-9-7-12(9)10-5-6-13-15(8-10)26-19(23)16-11(17(22)18(13,19)20)3-2-4-14(16)21(24)25/h2-6,8-9,12,23H,7,20H2,1H3/t9-,12+,18?,19?/m1/s1 |
| InChIKey | MPWCMFADNBXGSN-AMMXSDEGSA-N |
| XLogP | 2.31 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|