C17H27F4NO2 — CID 159376270
N-[2-(2-ethoxy-1,1-difluoroethoxy)-2,2-difluoroethyl]-2,2-bis(prop-2-enyl)pent-4-en-1-amine (PubChem CID 159376270) has the molecular formula C17H27F4NO2 and a molecular weight of 353.40 g/mol. Its IUPAC name is N-[2-(2-ethoxy-1,1-difluoroethoxy)-2,2-difluoroethyl]-2,2-bis(prop-2-enyl)pent-4-en-1-amine.
| Compound Name | N-[2-(2-ethoxy-1,1-difluoroethoxy)-2,2-difluoroethyl]-2,2-bis(prop-2-enyl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 159376270 |
| Molecular Formula | C17H27F4NO2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-[2-(2-ethoxy-1,1-difluoroethoxy)-2,2-difluoroethyl]-2,2-bis(prop-2-enyl)pent-4-en-1-amine |
| SMILES | C=CCC(CC=C)(CC=C)CNCC(F)(F)OC(F)(F)COCC |
| InChI | InChI=1S/C17H27F4NO2/c1-5-9-15(10-6-2,11-7-3)12-22-13-16(18,19)24-17(20,21)14-23-8-4/h5-7,22H,1-3,8-14H2,4H3 |
| InChIKey | UFDSPQPYEIAESP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|