C10H26N6O2 — CID 159377671
1-[(2R)-1-hydroxypropan-2-yl]-2,3-dimethylguanidine;2-[(2R)-1-hydroxypropan-2-yl]guanidine (PubChem CID 159377671) has the molecular formula C10H26N6O2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxypropan-2-yl]-2,3-dimethylguanidine;2-[(2R)-1-hydroxypropan-2-yl]guanidine.
| Compound Name | 1-[(2R)-1-hydroxypropan-2-yl]-2,3-dimethylguanidine;2-[(2R)-1-hydroxypropan-2-yl]guanidine |
|---|---|
| PubChem CID | 159377671 |
| Molecular Formula | C10H26N6O2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 1-[(2R)-1-hydroxypropan-2-yl]-2,3-dimethylguanidine;2-[(2R)-1-hydroxypropan-2-yl]guanidine |
| SMILES | C/N=C(\NC)N[C@H](C)CO.C[C@H](CO)N=C(N)N |
| InChI | InChI=1S/C6H15N3O.C4H11N3O/c1-5(4-10)9-6(7-2)8-3;1-3(2-8)7-4(5)6/h5,10H,4H2,1-3H3,(H2,7,8,9);3,8H,2H2,1H3,(H4,5,6,7)/t5-;3-/m11/s1 |
| InChIKey | LKNFQNWTVDONLU-FWNNTFJKSA-N |
| XLogP | -2.20 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|