C43H50O6 — CID 159377748
5-[(E)-2-(4-hydroxyphenyl)ethenyl]-2,4-bis(3-methylbut-2-enyl)benzene-1,3-diol;5-[2-(4-hydroxyphenyl)ethyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol (PubChem CID 159377748) has the molecular formula C43H50O6 and a molecular weight of 662.87 g/mol. Its IUPAC name is 5-[(E)-2-(4-hydroxyphenyl)ethenyl]-2,4-bis(3-methylbut-2-enyl)benzene-1,3-diol;5-[2-(4-hydroxyphenyl)ethyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol.
| Compound Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]-2,4-bis(3-methylbut-2-enyl)benzene-1,3-diol;5-[2-(4-hydroxyphenyl)ethyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 159377748 |
| Molecular Formula | C43H50O6 |
| Molecular Weight | 662.87 g/mol |
| Exact Mass | 662.36 |
| IUPAC Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]-2,4-bis(3-methylbut-2-enyl)benzene-1,3-diol;5-[2-(4-hydroxyphenyl)ethyl]-2-(3-methylbut-2-enyl)benzene-1,3-diol |
| SMILES | CC(C)=CCc1c(O)cc(/C=C/c2ccc(O)cc2)c(CC=C(C)C)c1O.CC(C)=CCc1c(O)cc(CCc2ccc(O)cc2)cc1O |
| InChI | InChI=1S/C24H28O3.C19H22O3/c1-16(2)5-13-21-19(10-7-18-8-11-20(25)12-9-18)15-23(26)22(24(21)27)14-6-17(3)4;1-13(2)3-10-17-18(21)11-15(12-19(17)22)5-4-14-6-8-16(20)9-7-14/h5-12,15,25-27H,13-14H2,1-4H3;3,6-9,11-12,20-22H,4-5,10H2,1-2H3/b10-7+; |
| InChIKey | LKNKLZHYRRRXFO-HCUGZAAXSA-N |
| XLogP | 10.09 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.87 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|