C29H30O2 — CID 159378092
methyl 5-[2-(9,10-diethylanthracen-2-yl)ethyl]-2-methylbenzoate (PubChem CID 159378092) has the molecular formula C29H30O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is methyl 5-[2-(9,10-diethylanthracen-2-yl)ethyl]-2-methylbenzoate.
| Compound Name | methyl 5-[2-(9,10-diethylanthracen-2-yl)ethyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 159378092 |
| Molecular Formula | C29H30O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | methyl 5-[2-(9,10-diethylanthracen-2-yl)ethyl]-2-methylbenzoate |
| SMILES | CCc1c2ccccc2c(CC)c2cc(CCc3ccc(C)c(C(=O)OC)c3)ccc12 |
| InChI | InChI=1S/C29H30O2/c1-5-22-24-9-7-8-10-25(24)23(6-2)28-18-21(15-16-26(22)28)14-13-20-12-11-19(3)27(17-20)29(30)31-4/h7-12,15-18H,5-6,13-14H2,1-4H3 |
| InChIKey | HVSQMQJRSMZDGT-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|