C26H23FN4O2 — CID 159378948
11-(3-fluoro-5-hydroxyphenyl)-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one (PubChem CID 159378948) has the molecular formula C26H23FN4O2 and a molecular weight of 442.49 g/mol. Its IUPAC name is 11-(3-fluoro-5-hydroxyphenyl)-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one.
| Compound Name | 11-(3-fluoro-5-hydroxyphenyl)-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
|---|---|
| PubChem CID | 159378948 |
| Molecular Formula | C26H23FN4O2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 11-(3-fluoro-5-hydroxyphenyl)-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
| SMILES | Cc1c[nH]c2nc(-c3cc(O)cc(F)c3)c3c(=O)[nH]c4cc(N5CCCCC5)ccc4c3c12 |
| InChI | InChI=1S/C26H23FN4O2/c1-14-13-28-25-21(14)22-19-6-5-17(31-7-3-2-4-8-31)12-20(19)29-26(33)23(22)24(30-25)15-9-16(27)11-18(32)10-15/h5-6,9-13,32H,2-4,7-8H2,1H3,(H,28,30)(H,29,33) |
| InChIKey | AYJHKPJXKOQDFX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|