About 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine
2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine (PubChem CID 15937908) has the molecular formula C10H14N4S
and a molecular weight of 222.32 g/mol. Its IUPAC name is 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine.
Molecular Properties
| Compound Name | 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine |
| PubChem CID | 15937908 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine |
| SMILES | CC(C)SCC1=NCc2nccnc2N1 |
| InChI | InChI=1S/C10H14N4S/c1-7(2)15-6-9-13-5-8-10(14-9)12-4-3-11-8/h3-4,7H,5-6H2,1-2H3,(H,12,13,14) |
| InChIKey | OKTAENSIZYZCOD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine?
The IUPAC name of 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine (CID 15937908) is 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine.
What is the SMILES notation for 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine?
The canonical SMILES for 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine is CC(C)SCC1=NCc2nccnc2N1.
What is the InChIKey of 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine?
The InChIKey is OKTAENSIZYZCOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4S/c1-7(2)15-6-9-13-5-8-10(14-9)12-4-3-11-8/h3-4,7H,5-6H2,1-2H3,(H,12,13,14).
What are the key properties of 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine?
2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine has a molecular weight of 222.32 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propan-2-ylsulfanylmethyl)-1,4-dihydropteridine is sourced from PubChem (CID 15937908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).