About 2-ethylidenepropanedioic acid;prop-2-enoic acid
2-ethylidenepropanedioic acid;prop-2-enoic acid (PubChem CID 159379532) has the molecular formula C8H10O6
and a molecular weight of 202.16 g/mol. Its IUPAC name is 2-ethylidenepropanedioic acid;prop-2-enoic acid.
Molecular Properties
| Compound Name | 2-ethylidenepropanedioic acid;prop-2-enoic acid |
| PubChem CID | 159379532 |
| Molecular Formula | C8H10O6 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 2-ethylidenepropanedioic acid;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC=C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C5H6O4.C3H4O2/c1-2-3(4(6)7)5(8)9;1-2-3(4)5/h2H,1H3,(H,6,7)(H,8,9);2H,1H2,(H,4,5) |
| InChIKey | LKSOXVJMJZONMQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylidenepropanedioic acid;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylidenepropanedioic acid;prop-2-enoic acid?
The IUPAC name of 2-ethylidenepropanedioic acid;prop-2-enoic acid (CID 159379532) is 2-ethylidenepropanedioic acid;prop-2-enoic acid.
What is the SMILES notation for 2-ethylidenepropanedioic acid;prop-2-enoic acid?
The canonical SMILES for 2-ethylidenepropanedioic acid;prop-2-enoic acid is C=CC(=O)O.CC=C(C(=O)O)C(=O)O.
What is the InChIKey of 2-ethylidenepropanedioic acid;prop-2-enoic acid?
The InChIKey is LKSOXVJMJZONMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4.C3H4O2/c1-2-3(4(6)7)5(8)9;1-2-3(4)5/h2H,1H3,(H,6,7)(H,8,9);2H,1H2,(H,4,5).
What are the key properties of 2-ethylidenepropanedioic acid;prop-2-enoic acid?
2-ethylidenepropanedioic acid;prop-2-enoic acid has a molecular weight of 202.16 g/mol, XLogP of 0.36, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylidenepropanedioic acid;prop-2-enoic acid is sourced from PubChem (CID 159379532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).