C46H38N8O4 — CID 159380757
[4-[[4-anilino-6-[[3-[[4-anilino-6-[(4-prop-2-enoyloxyphenyl)methyl]-1,3,5-triazin-2-yl]methyl]phenyl]methyl]-1,3,5-triazin-2-yl]methyl]phenyl] prop-2-enoate (PubChem CID 159380757) has the molecular formula C46H38N8O4 and a molecular weight of 766.86 g/mol. Its IUPAC name is [4-[[4-anilino-6-[[3-[[4-anilino-6-[(4-prop-2-enoyloxyphenyl)methyl]-1,3,5-triazin-2-yl]methyl]phenyl]methyl]-1,3,5-triazin-2-yl]methyl]phenyl] prop-2-enoate.
| Compound Name | [4-[[4-anilino-6-[[3-[[4-anilino-6-[(4-prop-2-enoyloxyphenyl)methyl]-1,3,5-triazin-2-yl]methyl]phenyl]methyl]-1,3,5-triazin-2-yl]methyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 159380757 |
| Molecular Formula | C46H38N8O4 |
| Molecular Weight | 766.86 g/mol |
| Exact Mass | 766.30 |
| IUPAC Name | [4-[[4-anilino-6-[[3-[[4-anilino-6-[(4-prop-2-enoyloxyphenyl)methyl]-1,3,5-triazin-2-yl]methyl]phenyl]methyl]-1,3,5-triazin-2-yl]methyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(Cc2nc(Cc3cccc(Cc4nc(Cc5ccc(OC(=O)C=C)cc5)nc(Nc5ccccc5)n4)c3)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C46H38N8O4/c1-3-43(55)57-37-22-18-31(19-23-37)27-39-49-41(53-45(51-39)47-35-14-7-5-8-15-35)29-33-12-11-13-34(26-33)30-42-50-40(52-46(54-42)48-36-16-9-6-10-17-36)28-32-20-24-38(25-21-32)58-44(56)4-2/h3-26H,1-2,27-30H2,(H,47,49,51,53)(H,48,50,52,54) |
| InChIKey | DJBUGXJWBFOECB-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 154.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.86 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|